C7H3NO2S — CID 22021687
1,3-benzothiazole-4,5-dione (PubChem CID 22021687) has the molecular formula C7H3NO2S and a molecular weight of 165.17 g/mol. Its IUPAC name is 1,3-benzothiazole-4,5-dione.
| Compound Name | 1,3-benzothiazole-4,5-dione |
|---|---|
| PubChem CID | 22021687 |
| Molecular Formula | C7H3NO2S |
| Molecular Weight | 165.17 g/mol |
| Exact Mass | 164.99 |
| IUPAC Name | 1,3-benzothiazole-4,5-dione |
| SMILES | O=C1C=Cc2scnc2C1=O |
| InChI | InChI=1S/C7H3NO2S/c9-4-1-2-5-6(7(4)10)8-3-11-5/h1-3H |
| InChIKey | BTVLKBLVIXQXLB-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.17 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|