C7H4N2O3S — CID 135732714
3-hydroxy-4-(1,3-thiazol-2-yl)pyrrole-2,5-dione (PubChem CID 135732714) has the molecular formula C7H4N2O3S and a molecular weight of 196.19 g/mol. Its IUPAC name is 3-hydroxy-4-(1,3-thiazol-2-yl)pyrrole-2,5-dione.
| Compound Name | 3-hydroxy-4-(1,3-thiazol-2-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 135732714 |
| Molecular Formula | C7H4N2O3S |
| Molecular Weight | 196.19 g/mol |
| Exact Mass | 195.99 |
| IUPAC Name | 3-hydroxy-4-(1,3-thiazol-2-yl)pyrrole-2,5-dione |
| SMILES | O=C1NC(=O)C(c2nccs2)=C1O |
| InChI | InChI=1S/C7H4N2O3S/c10-4-3(5(11)9-6(4)12)7-8-1-2-13-7/h1-2H,(H2,9,10,11,12) |
| InChIKey | KQWXLPLHMHVLMO-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.19 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|