C9H11NO2S — CID 174259583
5-(1,3-thiazol-2-yl)cyclohexa-1,5-dien-1-ol;hydrate (PubChem CID 174259583) has the molecular formula C9H11NO2S and a molecular weight of 197.26 g/mol. Its IUPAC name is 5-(1,3-thiazol-2-yl)cyclohexa-1,5-dien-1-ol;hydrate.
| Compound Name | 5-(1,3-thiazol-2-yl)cyclohexa-1,5-dien-1-ol;hydrate |
|---|---|
| PubChem CID | 174259583 |
| Molecular Formula | C9H11NO2S |
| Molecular Weight | 197.26 g/mol |
| Exact Mass | 197.05 |
| IUPAC Name | 5-(1,3-thiazol-2-yl)cyclohexa-1,5-dien-1-ol;hydrate |
| SMILES | O.OC1=CCCC(c2nccs2)=C1 |
| InChI | InChI=1S/C9H9NOS.H2O/c11-8-3-1-2-7(6-8)9-10-4-5-12-9;/h3-6,11H,1-2H2;1H2 |
| InChIKey | LXMMCRVODDXHDU-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 64.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.26 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |