C10H11NO2S2 — CID 167206505
6-(1,3-thiazol-2-yl)cyclohepta-1,6-diene-1-sulfinic acid (PubChem CID 167206505) has the molecular formula C10H11NO2S2 and a molecular weight of 241.34 g/mol. Its IUPAC name is 6-(1,3-thiazol-2-yl)cyclohepta-1,6-diene-1-sulfinic acid.
| Compound Name | 6-(1,3-thiazol-2-yl)cyclohepta-1,6-diene-1-sulfinic acid |
|---|---|
| PubChem CID | 167206505 |
| Molecular Formula | C10H11NO2S2 |
| Molecular Weight | 241.34 g/mol |
| Exact Mass | 241.02 |
| IUPAC Name | 6-(1,3-thiazol-2-yl)cyclohepta-1,6-diene-1-sulfinic acid |
| SMILES | O=S(O)C1=CCCCC(c2nccs2)=C1 |
| InChI | InChI=1S/C10H11NO2S2/c12-15(13)9-4-2-1-3-8(7-9)10-11-5-6-14-10/h4-7H,1-3H2,(H,12,13) |
| InChIKey | MLRMEYOVOUZRNL-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.34 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|