About 5-(1,3-thiazol-2-yl)-1H-pyrazin-2-one
5-(1,3-thiazol-2-yl)-1H-pyrazin-2-one (PubChem CID 165444968) has the molecular formula C7H5N3OS
and a molecular weight of 179.20 g/mol. Its IUPAC name is 5-(1,3-thiazol-2-yl)-1H-pyrazin-2-one.
Molecular Properties
| Compound Name | 5-(1,3-thiazol-2-yl)-1H-pyrazin-2-one |
| PubChem CID | 165444968 |
| Molecular Formula | C7H5N3OS |
| Molecular Weight | 179.20 g/mol |
| Exact Mass | 179.02 |
| IUPAC Name | 5-(1,3-thiazol-2-yl)-1H-pyrazin-2-one |
| SMILES | O=c1cnc(-c2nccs2)c[nH]1 |
| InChI | InChI=1S/C7H5N3OS/c11-6-4-9-5(3-10-6)7-8-1-2-12-7/h1-4H,(H,10,11) |
| InChIKey | NUCUOVDZZDCABA-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.20 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(1,3-thiazol-2-yl)-1H-pyrazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1,3-thiazol-2-yl)-1H-pyrazin-2-one?
The IUPAC name of 5-(1,3-thiazol-2-yl)-1H-pyrazin-2-one (CID 165444968) is 5-(1,3-thiazol-2-yl)-1H-pyrazin-2-one.
What is the SMILES notation for 5-(1,3-thiazol-2-yl)-1H-pyrazin-2-one?
The canonical SMILES for 5-(1,3-thiazol-2-yl)-1H-pyrazin-2-one is O=c1cnc(-c2nccs2)c[nH]1.
What is the InChIKey of 5-(1,3-thiazol-2-yl)-1H-pyrazin-2-one?
The InChIKey is NUCUOVDZZDCABA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5N3OS/c11-6-4-9-5(3-10-6)7-8-1-2-12-7/h1-4H,(H,10,11).
What are the key properties of 5-(1,3-thiazol-2-yl)-1H-pyrazin-2-one?
5-(1,3-thiazol-2-yl)-1H-pyrazin-2-one has a molecular weight of 179.20 g/mol, XLogP of 0.89, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1,3-thiazol-2-yl)-1H-pyrazin-2-one is sourced from PubChem (CID 165444968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).