C16H29N3O2 — CID 66735379
2-[1-(3,5-dimethylcyclohexyl)-1,3,5-triazinan-2-yl]ethyl prop-2-enoate (PubChem CID 66735379) has the molecular formula C16H29N3O2 and a molecular weight of 295.43 g/mol. Its IUPAC name is 2-[1-(3,5-dimethylcyclohexyl)-1,3,5-triazinan-2-yl]ethyl prop-2-enoate.
| Compound Name | 2-[1-(3,5-dimethylcyclohexyl)-1,3,5-triazinan-2-yl]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 66735379 |
| Molecular Formula | C16H29N3O2 |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.23 |
| IUPAC Name | 2-[1-(3,5-dimethylcyclohexyl)-1,3,5-triazinan-2-yl]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCC1NCNCN1C1CC(C)CC(C)C1 |
| InChI | InChI=1S/C16H29N3O2/c1-4-16(20)21-6-5-15-18-10-17-11-19(15)14-8-12(2)7-13(3)9-14/h4,12-15,17-18H,1,5-11H2,2-3H3 |
| InChIKey | OVFIDXPKMAIJFR-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|