C16H31N3O2 — CID 66735654
2-[1,5-di(butan-2-yl)-1,3,5-triazinan-2-yl]ethyl prop-2-enoate (PubChem CID 66735654) has the molecular formula C16H31N3O2 and a molecular weight of 297.44 g/mol. Its IUPAC name is 2-[1,5-di(butan-2-yl)-1,3,5-triazinan-2-yl]ethyl prop-2-enoate.
| Compound Name | 2-[1,5-di(butan-2-yl)-1,3,5-triazinan-2-yl]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 66735654 |
| Molecular Formula | C16H31N3O2 |
| Molecular Weight | 297.44 g/mol |
| Exact Mass | 297.24 |
| IUPAC Name | 2-[1,5-di(butan-2-yl)-1,3,5-triazinan-2-yl]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCC1NCN(C(C)CC)CN1C(C)CC |
| InChI | InChI=1S/C16H31N3O2/c1-6-13(4)18-11-17-15(9-10-21-16(20)8-3)19(12-18)14(5)7-2/h8,13-15,17H,3,6-7,9-12H2,1-2,4-5H3 |
| InChIKey | ZXMDSRZVEIALEK-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.44 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|