C12H18N4O6 — CID 66736701
2-N,2-N-bis(2,3-dihydroxypropyl)pyrazine-2,5-dicarboxamide (PubChem CID 66736701) has the molecular formula C12H18N4O6 and a molecular weight of 314.30 g/mol. Its IUPAC name is 2-N,2-N-bis(2,3-dihydroxypropyl)pyrazine-2,5-dicarboxamide.
| Compound Name | 2-N,2-N-bis(2,3-dihydroxypropyl)pyrazine-2,5-dicarboxamide |
|---|---|
| PubChem CID | 66736701 |
| Molecular Formula | C12H18N4O6 |
| Molecular Weight | 314.30 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | 2-N,2-N-bis(2,3-dihydroxypropyl)pyrazine-2,5-dicarboxamide |
| SMILES | NC(=O)c1cnc(C(=O)N(CC(O)CO)CC(O)CO)cn1 |
| InChI | InChI=1S/C12H18N4O6/c13-11(21)9-1-15-10(2-14-9)12(22)16(3-7(19)5-17)4-8(20)6-18/h1-2,7-8,17-20H,3-6H2,(H2,13,21) |
| InChIKey | FHJOOPPVARQDRY-UHFFFAOYSA-N |
| XLogP | -3.28 |
| TPSA | 170.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.30 |
| LogP ≤ 5 | -3.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |