C11H15Cl2N3O — CID 66749518
2-amino-4-[(3,5-dichlorophenyl)methylamino]butanamide (PubChem CID 66749518) has the molecular formula C11H15Cl2N3O and a molecular weight of 276.17 g/mol. Its IUPAC name is 2-amino-4-[(3,5-dichlorophenyl)methylamino]butanamide.
| Compound Name | 2-amino-4-[(3,5-dichlorophenyl)methylamino]butanamide |
|---|---|
| PubChem CID | 66749518 |
| Molecular Formula | C11H15Cl2N3O |
| Molecular Weight | 276.17 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | 2-amino-4-[(3,5-dichlorophenyl)methylamino]butanamide |
| SMILES | NC(=O)C(N)CCNCc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C11H15Cl2N3O/c12-8-3-7(4-9(13)5-8)6-16-2-1-10(14)11(15)17/h3-5,10,16H,1-2,6,14H2,(H2,15,17) |
| InChIKey | AVQFFVNULSCUFZ-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.17 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|