C15H15Cl2NO2 — CID 66752351
(3S)-3-[(R)-(3,5-dichlorophenoxy)-(furan-3-yl)methyl]pyrrolidine (PubChem CID 66752351) has the molecular formula C15H15Cl2NO2 and a molecular weight of 312.20 g/mol. Its IUPAC name is (3S)-3-[(R)-(3,5-dichlorophenoxy)-(furan-3-yl)methyl]pyrrolidine.
| Compound Name | (3S)-3-[(R)-(3,5-dichlorophenoxy)-(furan-3-yl)methyl]pyrrolidine |
|---|---|
| PubChem CID | 66752351 |
| Molecular Formula | C15H15Cl2NO2 |
| Molecular Weight | 312.20 g/mol |
| Exact Mass | 311.05 |
| IUPAC Name | (3S)-3-[(R)-(3,5-dichlorophenoxy)-(furan-3-yl)methyl]pyrrolidine |
| SMILES | Clc1cc(Cl)cc(O[C@@H](c2ccoc2)[C@H]2CCNC2)c1 |
| InChI | InChI=1S/C15H15Cl2NO2/c16-12-5-13(17)7-14(6-12)20-15(10-1-3-18-8-10)11-2-4-19-9-11/h2,4-7,9-10,15,18H,1,3,8H2/t10-,15+/m0/s1 |
| InChIKey | IOAAUTUYHHHRTC-ZUZCIYMTSA-N |
| XLogP | 4.32 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.20 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |