C22H23ClN2O5 — CID 66755266
tert-butyl 5-chloro-3-(2-ethoxy-2-oxo-1-phenylethyl)-2-oxobenzimidazole-1-carboxylate (PubChem CID 66755266) has the molecular formula C22H23ClN2O5 and a molecular weight of 430.89 g/mol. Its IUPAC name is tert-butyl 5-chloro-3-(2-ethoxy-2-oxo-1-phenylethyl)-2-oxobenzimidazole-1-carboxylate.
| Compound Name | tert-butyl 5-chloro-3-(2-ethoxy-2-oxo-1-phenylethyl)-2-oxobenzimidazole-1-carboxylate |
|---|---|
| PubChem CID | 66755266 |
| Molecular Formula | C22H23ClN2O5 |
| Molecular Weight | 430.89 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | tert-butyl 5-chloro-3-(2-ethoxy-2-oxo-1-phenylethyl)-2-oxobenzimidazole-1-carboxylate |
| SMILES | CCOC(=O)C(c1ccccc1)n1c(=O)n(C(=O)OC(C)(C)C)c2ccc(Cl)cc21 |
| InChI | InChI=1S/C22H23ClN2O5/c1-5-29-19(26)18(14-9-7-6-8-10-14)24-17-13-15(23)11-12-16(17)25(20(24)27)21(28)30-22(2,3)4/h6-13,18H,5H2,1-4H3 |
| InChIKey | HWAKXLYLZMRRPM-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 79.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.89 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |