C21H34BBrFeN6 — CID 66777234
iron;tris(3,5-diethyl-1H-pyrazol-4-yl)borane;hydrobromide (PubChem CID 66777234) has the molecular formula C21H34BBrFeN6 and a molecular weight of 517.11 g/mol. Its IUPAC name is iron;tris(3,5-diethyl-1H-pyrazol-4-yl)borane;hydrobromide.
| Compound Name | iron;tris(3,5-diethyl-1H-pyrazol-4-yl)borane;hydrobromide |
|---|---|
| PubChem CID | 66777234 |
| Molecular Formula | C21H34BBrFeN6 |
| Molecular Weight | 517.11 g/mol |
| Exact Mass | 516.15 |
| IUPAC Name | iron;tris(3,5-diethyl-1H-pyrazol-4-yl)borane;hydrobromide |
| SMILES | Br.CCc1n[nH]c(CC)c1B(c1c(CC)n[nH]c1CC)c1c(CC)n[nH]c1CC.[Fe] |
| InChI | InChI=1S/C21H33BN6.BrH.Fe/c1-7-13-19(14(8-2)24-23-13)22(20-15(9-3)25-26-16(20)10-4)21-17(11-5)27-28-18(21)12-6;;/h7-12H2,1-6H3,(H,23,24)(H,25,26)(H,27,28);1H; |
| InChIKey | OLVAIDLFFXNQNR-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 86.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.11 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|