C23H28O6S2 — CID 66777805
2-benzyl-2-(methylsulfanylmethyl)propanedioic acid;2-benzyl-3-methylsulfanylpropanoic acid (PubChem CID 66777805) has the molecular formula C23H28O6S2 and a molecular weight of 464.61 g/mol. Its IUPAC name is 2-benzyl-2-(methylsulfanylmethyl)propanedioic acid;2-benzyl-3-methylsulfanylpropanoic acid.
| Compound Name | 2-benzyl-2-(methylsulfanylmethyl)propanedioic acid;2-benzyl-3-methylsulfanylpropanoic acid |
|---|---|
| PubChem CID | 66777805 |
| Molecular Formula | C23H28O6S2 |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.13 |
| IUPAC Name | 2-benzyl-2-(methylsulfanylmethyl)propanedioic acid;2-benzyl-3-methylsulfanylpropanoic acid |
| SMILES | CSCC(Cc1ccccc1)(C(=O)O)C(=O)O.CSCC(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C12H14O4S.C11H14O2S/c1-17-8-12(10(13)14,11(15)16)7-9-5-3-2-4-6-9;1-14-8-10(11(12)13)7-9-5-3-2-4-6-9/h2-6H,7-8H2,1H3,(H,13,14)(H,15,16);2-6,10H,7-8H2,1H3,(H,12,13) |
| InChIKey | GWDMPRKPTMORGK-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|