C37H53BN4O6 — CID 66786579
tert-butyl-[(2R)-4-[(3R)-3-[1-(3-methoxypropyl)benzimidazol-2-yl]piperidin-1-yl]-4-oxo-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]butan-2-yl]carbamic acid (PubChem CID 66786579) has the molecular formula C37H53BN4O6 and a molecular weight of 660.67 g/mol. Its IUPAC name is tert-butyl-[(2R)-4-[(3R)-3-[1-(3-methoxypropyl)benzimidazol-2-yl]piperidin-1-yl]-4-oxo-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]butan-2-yl]carbamic acid.
| Compound Name | tert-butyl-[(2R)-4-[(3R)-3-[1-(3-methoxypropyl)benzimidazol-2-yl]piperidin-1-yl]-4-oxo-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]butan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 66786579 |
| Molecular Formula | C37H53BN4O6 |
| Molecular Weight | 660.67 g/mol |
| Exact Mass | 660.41 |
| IUPAC Name | tert-butyl-[(2R)-4-[(3R)-3-[1-(3-methoxypropyl)benzimidazol-2-yl]piperidin-1-yl]-4-oxo-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]butan-2-yl]carbamic acid |
| SMILES | COCCCn1c([C@@H]2CCCN(C(=O)C[C@@H](Cc3ccc(B4OC(C)(C)C(C)(C)O4)cc3)N(C(=O)O)C(C)(C)C)C2)nc2ccccc21 |
| InChI | InChI=1S/C37H53BN4O6/c1-35(2,3)42(34(44)45)29(23-26-16-18-28(19-17-26)38-47-36(4,5)37(6,7)48-38)24-32(43)40-20-11-13-27(25-40)33-39-30-14-9-10-15-31(30)41(33)21-12-22-46-8/h9-10,14-19,27,29H,11-13,20-25H2,1-8H3,(H,44,45)/t27-,29-/m1/s1 |
| InChIKey | YTGAWVYNYRYABO-XRKRLSELSA-N |
| XLogP | 5.86 |
| TPSA | 106.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.67 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|