C17H32N4O — CID 66790818
N-(1,6-diethyl-5-hexyl-2H-triazin-4-yl)butanamide (PubChem CID 66790818) has the molecular formula C17H32N4O and a molecular weight of 308.47 g/mol. Its IUPAC name is N-(1,6-diethyl-5-hexyl-2H-triazin-4-yl)butanamide.
| Compound Name | N-(1,6-diethyl-5-hexyl-2H-triazin-4-yl)butanamide |
|---|---|
| PubChem CID | 66790818 |
| Molecular Formula | C17H32N4O |
| Molecular Weight | 308.47 g/mol |
| Exact Mass | 308.26 |
| IUPAC Name | N-(1,6-diethyl-5-hexyl-2H-triazin-4-yl)butanamide |
| SMILES | CCCCCCC1=C(CC)N(CC)NN=C1NC(=O)CCC |
| InChI | InChI=1S/C17H32N4O/c1-5-9-10-11-13-14-15(7-3)21(8-4)20-19-17(14)18-16(22)12-6-2/h20H,5-13H2,1-4H3,(H,18,19,22) |
| InChIKey | ASHAYILRHJPCAV-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.47 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|