C13H14BrFN2O7 — CID 66792987
5-bromo-1-[(2R,3R,4R,5R)-2,3-diacetyl-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 66792987) has the molecular formula C13H14BrFN2O7 and a molecular weight of 409.16 g/mol. Its IUPAC name is 5-bromo-1-[(2R,3R,4R,5R)-2,3-diacetyl-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 5-bromo-1-[(2R,3R,4R,5R)-2,3-diacetyl-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 66792987 |
| Molecular Formula | C13H14BrFN2O7 |
| Molecular Weight | 409.16 g/mol |
| Exact Mass | 408.00 |
| IUPAC Name | 5-bromo-1-[(2R,3R,4R,5R)-2,3-diacetyl-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | CC(=O)[C@@]1(F)[C@H](O)[C@@H](CO)O[C@@]1(C(C)=O)n1cc(Br)c(=O)[nH]c1=O |
| InChI | InChI=1S/C13H14BrFN2O7/c1-5(19)12(15)9(21)8(4-18)24-13(12,6(2)20)17-3-7(14)10(22)16-11(17)23/h3,8-9,18,21H,4H2,1-2H3,(H,16,22,23)/t8-,9-,12-,13-/m1/s1 |
| InChIKey | JKUHGAZZRALYBB-NRMKKVEVSA-N |
| XLogP | -1.41 |
| TPSA | 138.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.16 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |