C15H12Cl2N2O4S — CID 66800863
1-(3,4-dichlorophenyl)-1-(2,3-dihydro-1-benzofuran-2-ylsulfonyl)urea (PubChem CID 66800863) has the molecular formula C15H12Cl2N2O4S and a molecular weight of 387.24 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-1-(2,3-dihydro-1-benzofuran-2-ylsulfonyl)urea.
| Compound Name | 1-(3,4-dichlorophenyl)-1-(2,3-dihydro-1-benzofuran-2-ylsulfonyl)urea |
|---|---|
| PubChem CID | 66800863 |
| Molecular Formula | C15H12Cl2N2O4S |
| Molecular Weight | 387.24 g/mol |
| Exact Mass | 385.99 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-1-(2,3-dihydro-1-benzofuran-2-ylsulfonyl)urea |
| SMILES | NC(=O)N(c1ccc(Cl)c(Cl)c1)S(=O)(=O)C1Cc2ccccc2O1 |
| InChI | InChI=1S/C15H12Cl2N2O4S/c16-11-6-5-10(8-12(11)17)19(15(18)20)24(21,22)14-7-9-3-1-2-4-13(9)23-14/h1-6,8,14H,7H2,(H2,18,20) |
| InChIKey | NJDODDBCDFOJEQ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.24 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |