C33H35ClN4O5Si — CID 66813412
(2S)-3-[2-[tert-butyl(diphenyl)silyl]oxyethoxy]-2-[1-(2-chlorophenyl)pyrazolo[5,4-d]pyrimidin-4-yl]oxybutanoic acid (PubChem CID 66813412) has the molecular formula C33H35ClN4O5Si and a molecular weight of 631.21 g/mol. Its IUPAC name is (2S)-3-[2-[tert-butyl(diphenyl)silyl]oxyethoxy]-2-[1-(2-chlorophenyl)pyrazolo[5,4-d]pyrimidin-4-yl]oxybutanoic acid.
| Compound Name | (2S)-3-[2-[tert-butyl(diphenyl)silyl]oxyethoxy]-2-[1-(2-chlorophenyl)pyrazolo[5,4-d]pyrimidin-4-yl]oxybutanoic acid |
|---|---|
| PubChem CID | 66813412 |
| Molecular Formula | C33H35ClN4O5Si |
| Molecular Weight | 631.21 g/mol |
| Exact Mass | 630.21 |
| IUPAC Name | (2S)-3-[2-[tert-butyl(diphenyl)silyl]oxyethoxy]-2-[1-(2-chlorophenyl)pyrazolo[5,4-d]pyrimidin-4-yl]oxybutanoic acid |
| SMILES | CC(OCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@H](Oc1ncnc2c1cnn2-c1ccccc1Cl)C(=O)O |
| InChI | InChI=1S/C33H35ClN4O5Si/c1-23(41-19-20-42-44(33(2,3)4,24-13-7-5-8-14-24)25-15-9-6-10-16-25)29(32(39)40)43-31-26-21-37-38(30(26)35-22-36-31)28-18-12-11-17-27(28)34/h5-18,21-23,29H,19-20H2,1-4H3,(H,39,40)/t23?,29-/m0/s1 |
| InChIKey | ZMESIXKHLBZPJH-IZCXSWDTSA-N |
| XLogP | 5.28 |
| TPSA | 108.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.21 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|