C22H25N3O2 — CID 66821462
(3aS,10bS)-2-methyl-6-oxo-N-(2-phenylethyl)-1,3,3a,4,5,10b-hexahydropyrrolo[3,4-d][2]benzazepine-8-carboxamide (PubChem CID 66821462) has the molecular formula C22H25N3O2 and a molecular weight of 363.46 g/mol. Its IUPAC name is (3aS,10bS)-2-methyl-6-oxo-N-(2-phenylethyl)-1,3,3a,4,5,10b-hexahydropyrrolo[3,4-d][2]benzazepine-8-carboxamide.
| Compound Name | (3aS,10bS)-2-methyl-6-oxo-N-(2-phenylethyl)-1,3,3a,4,5,10b-hexahydropyrrolo[3,4-d][2]benzazepine-8-carboxamide |
|---|---|
| PubChem CID | 66821462 |
| Molecular Formula | C22H25N3O2 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | (3aS,10bS)-2-methyl-6-oxo-N-(2-phenylethyl)-1,3,3a,4,5,10b-hexahydropyrrolo[3,4-d][2]benzazepine-8-carboxamide |
| SMILES | CN1C[C@@H]2CNC(=O)c3cc(C(=O)NCCc4ccccc4)ccc3[C@H]2C1 |
| InChI | InChI=1S/C22H25N3O2/c1-25-13-17-12-24-22(27)19-11-16(7-8-18(19)20(17)14-25)21(26)23-10-9-15-5-3-2-4-6-15/h2-8,11,17,20H,9-10,12-14H2,1H3,(H,23,26)(H,24,27)/t17-,20-/m0/s1 |
| InChIKey | OBLBFMXGXWTUTG-PXNSSMCTSA-N |
| XLogP | 2.05 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |