C28H28ClN3O4 — CID 66826809
[(3R)-3-[(2-chlorobenzoyl)-[(1-pyridin-4-ylpiperidin-3-yl)methyl]amino]-2,3-dihydro-1H-inden-5-yl] hydrogen carbonate (PubChem CID 66826809) has the molecular formula C28H28ClN3O4 and a molecular weight of 506.00 g/mol. Its IUPAC name is [(3R)-3-[(2-chlorobenzoyl)-[(1-pyridin-4-ylpiperidin-3-yl)methyl]amino]-2,3-dihydro-1H-inden-5-yl] hydrogen carbonate.
| Compound Name | [(3R)-3-[(2-chlorobenzoyl)-[(1-pyridin-4-ylpiperidin-3-yl)methyl]amino]-2,3-dihydro-1H-inden-5-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 66826809 |
| Molecular Formula | C28H28ClN3O4 |
| Molecular Weight | 506.00 g/mol |
| Exact Mass | 505.18 |
| IUPAC Name | [(3R)-3-[(2-chlorobenzoyl)-[(1-pyridin-4-ylpiperidin-3-yl)methyl]amino]-2,3-dihydro-1H-inden-5-yl] hydrogen carbonate |
| SMILES | O=C(O)Oc1ccc2c(c1)[C@H](N(CC1CCCN(c3ccncc3)C1)C(=O)c1ccccc1Cl)CC2 |
| InChI | InChI=1S/C28H28ClN3O4/c29-25-6-2-1-5-23(25)27(33)32(18-19-4-3-15-31(17-19)21-11-13-30-14-12-21)26-10-8-20-7-9-22(16-24(20)26)36-28(34)35/h1-2,5-7,9,11-14,16,19,26H,3-4,8,10,15,17-18H2,(H,34,35)/t19?,26-/m1/s1 |
| InChIKey | LDJMJEDWLQFDQN-COTLDPOVSA-N |
| XLogP | 5.84 |
| TPSA | 82.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.00 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|