C29H32ClN4O4+ — CID 87170815
(5-carboxyoxy-2,3-dihydro-1H-inden-1-yl)-[(2-chlorophenyl)-methylcarbamoyl]-methyl-(1-pyridin-4-ylpiperidin-4-yl)azanium (PubChem CID 87170815) has the molecular formula C29H32ClN4O4+ and a molecular weight of 536.05 g/mol. Its IUPAC name is (5-carboxyoxy-2,3-dihydro-1H-inden-1-yl)-[(2-chlorophenyl)-methylcarbamoyl]-methyl-(1-pyridin-4-ylpiperidin-4-yl)azanium.
| Compound Name | (5-carboxyoxy-2,3-dihydro-1H-inden-1-yl)-[(2-chlorophenyl)-methylcarbamoyl]-methyl-(1-pyridin-4-ylpiperidin-4-yl)azanium |
|---|---|
| PubChem CID | 87170815 |
| Molecular Formula | C29H32ClN4O4+ |
| Molecular Weight | 536.05 g/mol |
| Exact Mass | 535.21 |
| IUPAC Name | (5-carboxyoxy-2,3-dihydro-1H-inden-1-yl)-[(2-chlorophenyl)-methylcarbamoyl]-methyl-(1-pyridin-4-ylpiperidin-4-yl)azanium |
| SMILES | CN(C(=O)[N+](C)(C1CCN(c2ccncc2)CC1)C1CCc2cc(OC(=O)O)ccc21)c1ccccc1Cl |
| InChI | InChI=1S/C29H31ClN4O4/c1-32(26-6-4-3-5-25(26)30)28(35)34(2,22-13-17-33(18-14-22)21-11-15-31-16-12-21)27-10-7-20-19-23(38-29(36)37)8-9-24(20)27/h3-6,8-9,11-12,15-16,19,22,27H,7,10,13-14,17-18H2,1-2H3/p+1 |
| InChIKey | DQFCMOIPCQEBCW-UHFFFAOYSA-O |
| XLogP | 6.15 |
| TPSA | 82.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.05 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|