C27H29FN3O5S+ — CID 87170723
[(1R)-6-carboxyoxy-2,3-dihydro-1H-inden-1-yl]-(4-fluorophenyl)sulfonyl-methyl-(1-pyridin-4-ylpiperidin-4-yl)azanium (PubChem CID 87170723) has the molecular formula C27H29FN3O5S+ and a molecular weight of 526.61 g/mol. Its IUPAC name is [(1R)-6-carboxyoxy-2,3-dihydro-1H-inden-1-yl]-(4-fluorophenyl)sulfonyl-methyl-(1-pyridin-4-ylpiperidin-4-yl)azanium.
| Compound Name | [(1R)-6-carboxyoxy-2,3-dihydro-1H-inden-1-yl]-(4-fluorophenyl)sulfonyl-methyl-(1-pyridin-4-ylpiperidin-4-yl)azanium |
|---|---|
| PubChem CID | 87170723 |
| Molecular Formula | C27H29FN3O5S+ |
| Molecular Weight | 526.61 g/mol |
| Exact Mass | 526.18 |
| IUPAC Name | [(1R)-6-carboxyoxy-2,3-dihydro-1H-inden-1-yl]-(4-fluorophenyl)sulfonyl-methyl-(1-pyridin-4-ylpiperidin-4-yl)azanium |
| SMILES | C[N+](C1CCN(c2ccncc2)CC1)([C@@H]1CCc2ccc(OC(=O)O)cc21)S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C27H28FN3O5S/c1-31(37(34,35)24-7-4-20(28)5-8-24,22-12-16-30(17-13-22)21-10-14-29-15-11-21)26-9-3-19-2-6-23(18-25(19)26)36-27(32)33/h2,4-8,10-11,14-15,18,22,26H,3,9,12-13,16-17H2,1H3/p+1/t26-,31?/m1/s1 |
| InChIKey | ORHIKSFVROAYNX-SYQKMTEESA-O |
| XLogP | 4.77 |
| TPSA | 96.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.61 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|