C32H40NO7Si — CID 66834617
CID 66834617 (PubChem CID 66834617) has the molecular formula C32H40NO7Si and a molecular weight of 578.76 g/mol.
| Compound Name | CID 66834617 |
|---|---|
| PubChem CID | 66834617 |
| Molecular Formula | C32H40NO7Si |
| Molecular Weight | 578.76 g/mol |
| Exact Mass | 578.26 |
| IUPAC Name | — |
| SMILES | C[Si](C)OC([C@@H]1OC(C)(C)O[C@@H]1COc1ccc2c(c1)C(C)(C)c1[nH]c3cc(C(=O)O)ccc3c1C2=O)C(C)(C)C |
| InChI | InChI=1S/C32H40NO7Si/c1-30(2,3)28(40-41(8)9)26-23(38-32(6,7)39-26)16-37-18-11-13-19-21(15-18)31(4,5)27-24(25(19)34)20-12-10-17(29(35)36)14-22(20)33-27/h10-15,23,26,28,33H,16H2,1-9H3,(H,35,36)/t23-,26-,28?/m1/s1 |
| InChIKey | KPMJSONJSLPFNT-ONCFSFCTSA-N |
| XLogP | 6.32 |
| TPSA | 107.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.76 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|