C23H26N2O5S — CID 66851915
[4-[(5-hydroxy-2-adamantyl)carbamoyl]phenoxy]-pyridin-2-ylmethanesulfinic acid (PubChem CID 66851915) has the molecular formula C23H26N2O5S and a molecular weight of 442.54 g/mol. Its IUPAC name is [4-[(5-hydroxy-2-adamantyl)carbamoyl]phenoxy]-pyridin-2-ylmethanesulfinic acid.
| Compound Name | [4-[(5-hydroxy-2-adamantyl)carbamoyl]phenoxy]-pyridin-2-ylmethanesulfinic acid |
|---|---|
| PubChem CID | 66851915 |
| Molecular Formula | C23H26N2O5S |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | [4-[(5-hydroxy-2-adamantyl)carbamoyl]phenoxy]-pyridin-2-ylmethanesulfinic acid |
| SMILES | O=C(NC1C2CC3CC1CC(O)(C3)C2)c1ccc(OC(c2ccccn2)S(=O)O)cc1 |
| InChI | InChI=1S/C23H26N2O5S/c26-21(25-20-16-9-14-10-17(20)13-23(27,11-14)12-16)15-4-6-18(7-5-15)30-22(31(28)29)19-3-1-2-8-24-19/h1-8,14,16-17,20,22,27H,9-13H2,(H,25,26)(H,28,29) |
| InChIKey | CLCKDPSNRHNTRD-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 108.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|