C39H34F3N3O5 — CID 66870505
5-(1,3-benzodioxol-5-yl)-3-[5-[3-[3-benzyl-8-(trifluoromethyl)quinolin-4-yl]phenoxy]pentyl]-5-methylimidazolidine-2,4-dione (PubChem CID 66870505) has the molecular formula C39H34F3N3O5 and a molecular weight of 681.71 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-yl)-3-[5-[3-[3-benzyl-8-(trifluoromethyl)quinolin-4-yl]phenoxy]pentyl]-5-methylimidazolidine-2,4-dione.
| Compound Name | 5-(1,3-benzodioxol-5-yl)-3-[5-[3-[3-benzyl-8-(trifluoromethyl)quinolin-4-yl]phenoxy]pentyl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 66870505 |
| Molecular Formula | C39H34F3N3O5 |
| Molecular Weight | 681.71 g/mol |
| Exact Mass | 681.25 |
| IUPAC Name | 5-(1,3-benzodioxol-5-yl)-3-[5-[3-[3-benzyl-8-(trifluoromethyl)quinolin-4-yl]phenoxy]pentyl]-5-methylimidazolidine-2,4-dione |
| SMILES | CC1(c2ccc3c(c2)OCO3)NC(=O)N(CCCCCOc2cccc(-c3c(Cc4ccccc4)cnc4c(C(F)(F)F)cccc34)c2)C1=O |
| InChI | InChI=1S/C39H34F3N3O5/c1-38(28-16-17-32-33(22-28)50-24-49-32)36(46)45(37(47)44-38)18-6-3-7-19-48-29-13-8-12-26(21-29)34-27(20-25-10-4-2-5-11-25)23-43-35-30(34)14-9-15-31(35)39(40,41)42/h2,4-5,8-17,21-23H,3,6-7,18-20,24H2,1H3,(H,44,47) |
| InChIKey | CTDZHWPPDUJIDF-UHFFFAOYSA-N |
| XLogP | 8.26 |
| TPSA | 89.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.71 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|