C27H28NO3+ — CID 66885553
3-[4-(4-methoxyphenyl)-2-(1-phenylethyl)isoquinolin-2-ium-7-yl]oxypropan-1-ol (PubChem CID 66885553) has the molecular formula C27H28NO3+ and a molecular weight of 414.53 g/mol. Its IUPAC name is 3-[4-(4-methoxyphenyl)-2-(1-phenylethyl)isoquinolin-2-ium-7-yl]oxypropan-1-ol.
| Compound Name | 3-[4-(4-methoxyphenyl)-2-(1-phenylethyl)isoquinolin-2-ium-7-yl]oxypropan-1-ol |
|---|---|
| PubChem CID | 66885553 |
| Molecular Formula | C27H28NO3+ |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | 3-[4-(4-methoxyphenyl)-2-(1-phenylethyl)isoquinolin-2-ium-7-yl]oxypropan-1-ol |
| SMILES | COc1ccc(-c2c[n+](C(C)c3ccccc3)cc3cc(OCCCO)ccc23)cc1 |
| InChI | InChI=1S/C27H28NO3/c1-20(21-7-4-3-5-8-21)28-18-23-17-25(31-16-6-15-29)13-14-26(23)27(19-28)22-9-11-24(30-2)12-10-22/h3-5,7-14,17-20,29H,6,15-16H2,1-2H3/q+1 |
| InChIKey | GEHMSDGFIYHHNB-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 42.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|