C19H19N5O2 — CID 66887127
5-hydroxy-4-(oxan-4-ylmethyl)-3,5,10,13,15-pentazatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),2(6),3,7(12),8,10,15,17-octaene (PubChem CID 66887127) has the molecular formula C19H19N5O2 and a molecular weight of 349.39 g/mol. Its IUPAC name is 5-hydroxy-4-(oxan-4-ylmethyl)-3,5,10,13,15-pentazatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),2(6),3,7(12),8,10,15,17-octaene.
| Compound Name | 5-hydroxy-4-(oxan-4-ylmethyl)-3,5,10,13,15-pentazatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),2(6),3,7(12),8,10,15,17-octaene |
|---|---|
| PubChem CID | 66887127 |
| Molecular Formula | C19H19N5O2 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | 5-hydroxy-4-(oxan-4-ylmethyl)-3,5,10,13,15-pentazatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),2(6),3,7(12),8,10,15,17-octaene |
| SMILES | On1c(CC2CCOCC2)nc2c1-c1ccncc1Nc1ncccc1-2 |
| InChI | InChI=1S/C19H19N5O2/c25-24-16(10-12-4-8-26-9-5-12)23-17-14-2-1-6-21-19(14)22-15-11-20-7-3-13(15)18(17)24/h1-3,6-7,11-12,25H,4-5,8-10H2,(H,21,22) |
| InChIKey | VSEPFCBIKAMGEQ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|