C9H12N2O2 — CID 66892966
2-(2,2-dimethyl-1,3-dioxolan-4-yl)pyrazine (PubChem CID 66892966) has the molecular formula C9H12N2O2 and a molecular weight of 180.21 g/mol. Its IUPAC name is 2-(2,2-dimethyl-1,3-dioxolan-4-yl)pyrazine.
| Compound Name | 2-(2,2-dimethyl-1,3-dioxolan-4-yl)pyrazine |
|---|---|
| PubChem CID | 66892966 |
| Molecular Formula | C9H12N2O2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | 2-(2,2-dimethyl-1,3-dioxolan-4-yl)pyrazine |
| SMILES | CC1(C)OCC(c2cnccn2)O1 |
| InChI | InChI=1S/C9H12N2O2/c1-9(2)12-6-8(13-9)7-5-10-3-4-11-7/h3-5,8H,6H2,1-2H3 |
| InChIKey | MWVCIFWRIXDPBU-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |