C16H14FN3O5S — CID 66907690
N-[(2,4-dioxoimidazolidin-1-yl)methyl]-4-(4-fluorophenoxy)benzenesulfonamide (PubChem CID 66907690) has the molecular formula C16H14FN3O5S and a molecular weight of 379.37 g/mol. Its IUPAC name is N-[(2,4-dioxoimidazolidin-1-yl)methyl]-4-(4-fluorophenoxy)benzenesulfonamide.
| Compound Name | N-[(2,4-dioxoimidazolidin-1-yl)methyl]-4-(4-fluorophenoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 66907690 |
| Molecular Formula | C16H14FN3O5S |
| Molecular Weight | 379.37 g/mol |
| Exact Mass | 379.06 |
| IUPAC Name | N-[(2,4-dioxoimidazolidin-1-yl)methyl]-4-(4-fluorophenoxy)benzenesulfonamide |
| SMILES | O=C1CN(CNS(=O)(=O)c2ccc(Oc3ccc(F)cc3)cc2)C(=O)N1 |
| InChI | InChI=1S/C16H14FN3O5S/c17-11-1-3-12(4-2-11)25-13-5-7-14(8-6-13)26(23,24)18-10-20-9-15(21)19-16(20)22/h1-8,18H,9-10H2,(H,19,21,22) |
| InChIKey | JIGHTZYTRCVVQN-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.37 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|