C21H25N3O6S — CID 66911821
6-[2-[N-(2-hydroxyethyl)-2-(methanesulfonamido)anilino]ethoxy]-3-methyl-1H-indole-2-carboxylic acid (PubChem CID 66911821) has the molecular formula C21H25N3O6S and a molecular weight of 447.51 g/mol. Its IUPAC name is 6-[2-[N-(2-hydroxyethyl)-2-(methanesulfonamido)anilino]ethoxy]-3-methyl-1H-indole-2-carboxylic acid.
| Compound Name | 6-[2-[N-(2-hydroxyethyl)-2-(methanesulfonamido)anilino]ethoxy]-3-methyl-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 66911821 |
| Molecular Formula | C21H25N3O6S |
| Molecular Weight | 447.51 g/mol |
| Exact Mass | 447.15 |
| IUPAC Name | 6-[2-[N-(2-hydroxyethyl)-2-(methanesulfonamido)anilino]ethoxy]-3-methyl-1H-indole-2-carboxylic acid |
| SMILES | Cc1c(C(=O)O)[nH]c2cc(OCCN(CCO)c3ccccc3NS(C)(=O)=O)ccc12 |
| InChI | InChI=1S/C21H25N3O6S/c1-14-16-8-7-15(13-18(16)22-20(14)21(26)27)30-12-10-24(9-11-25)19-6-4-3-5-17(19)23-31(2,28)29/h3-8,13,22-23,25H,9-12H2,1-2H3,(H,26,27) |
| InChIKey | SAUCRWVIBIUJHC-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 131.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.51 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|