C22H27N3O6S — CID 66911897
2-[6-[2-[N-(2-hydroxyethyl)-2-(methanesulfonamido)anilino]ethoxy]-2-methyl-1H-indol-3-yl]acetic acid (PubChem CID 66911897) has the molecular formula C22H27N3O6S and a molecular weight of 461.54 g/mol. Its IUPAC name is 2-[6-[2-[N-(2-hydroxyethyl)-2-(methanesulfonamido)anilino]ethoxy]-2-methyl-1H-indol-3-yl]acetic acid.
| Compound Name | 2-[6-[2-[N-(2-hydroxyethyl)-2-(methanesulfonamido)anilino]ethoxy]-2-methyl-1H-indol-3-yl]acetic acid |
|---|---|
| PubChem CID | 66911897 |
| Molecular Formula | C22H27N3O6S |
| Molecular Weight | 461.54 g/mol |
| Exact Mass | 461.16 |
| IUPAC Name | 2-[6-[2-[N-(2-hydroxyethyl)-2-(methanesulfonamido)anilino]ethoxy]-2-methyl-1H-indol-3-yl]acetic acid |
| SMILES | Cc1[nH]c2cc(OCCN(CCO)c3ccccc3NS(C)(=O)=O)ccc2c1CC(=O)O |
| InChI | InChI=1S/C22H27N3O6S/c1-15-18(14-22(27)28)17-8-7-16(13-20(17)23-15)31-12-10-25(9-11-26)21-6-4-3-5-19(21)24-32(2,29)30/h3-8,13,23-24,26H,9-12,14H2,1-2H3,(H,27,28) |
| InChIKey | LZFPWBPUPPLEJV-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 131.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.54 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|