C15H11Cl2F2NOS — CID 66922576
3-amino-3-(4-chlorophenyl)sulfanyl-1-(2,4-difluorophenyl)prop-2-en-1-one;hydrochloride (PubChem CID 66922576) has the molecular formula C15H11Cl2F2NOS and a molecular weight of 362.23 g/mol. Its IUPAC name is 3-amino-3-(4-chlorophenyl)sulfanyl-1-(2,4-difluorophenyl)prop-2-en-1-one;hydrochloride.
| Compound Name | 3-amino-3-(4-chlorophenyl)sulfanyl-1-(2,4-difluorophenyl)prop-2-en-1-one;hydrochloride |
|---|---|
| PubChem CID | 66922576 |
| Molecular Formula | C15H11Cl2F2NOS |
| Molecular Weight | 362.23 g/mol |
| Exact Mass | 360.99 |
| IUPAC Name | 3-amino-3-(4-chlorophenyl)sulfanyl-1-(2,4-difluorophenyl)prop-2-en-1-one;hydrochloride |
| SMILES | Cl.NC(=CC(=O)c1ccc(F)cc1F)Sc1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H10ClF2NOS.ClH/c16-9-1-4-11(5-2-9)21-15(19)8-14(20)12-6-3-10(17)7-13(12)18;/h1-8H,19H2;1H |
| InChIKey | TWOIVXRSTXAGRZ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.23 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|