C24H29NO8 — CID 66931180
(2S)-2-[2-benzoyloxypropyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-(3,4-dihydroxyphenyl)propanoic acid (PubChem CID 66931180) has the molecular formula C24H29NO8 and a molecular weight of 459.50 g/mol. Its IUPAC name is (2S)-2-[2-benzoyloxypropyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-(3,4-dihydroxyphenyl)propanoic acid.
| Compound Name | (2S)-2-[2-benzoyloxypropyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-(3,4-dihydroxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 66931180 |
| Molecular Formula | C24H29NO8 |
| Molecular Weight | 459.50 g/mol |
| Exact Mass | 459.19 |
| IUPAC Name | (2S)-2-[2-benzoyloxypropyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-(3,4-dihydroxyphenyl)propanoic acid |
| SMILES | CC(CN(C(=O)OC(C)(C)C)[C@@H](Cc1ccc(O)c(O)c1)C(=O)O)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C24H29NO8/c1-15(32-22(30)17-8-6-5-7-9-17)14-25(23(31)33-24(2,3)4)18(21(28)29)12-16-10-11-19(26)20(27)13-16/h5-11,13,15,18,26-27H,12,14H2,1-4H3,(H,28,29)/t15?,18-/m0/s1 |
| InChIKey | HCQTVLBMNXCFPI-PKHIMPSTSA-N |
| XLogP | 3.58 |
| TPSA | 133.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.50 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|