C20H23NO9S — CID 88941418
[[(2S)-1-[(2R)-2-benzoyloxypropoxy]-3-(3,4-dihydroxyphenyl)-1-oxopropan-2-yl]amino]methanesulfonic acid (PubChem CID 88941418) has the molecular formula C20H23NO9S and a molecular weight of 453.47 g/mol. Its IUPAC name is [[(2S)-1-[(2R)-2-benzoyloxypropoxy]-3-(3,4-dihydroxyphenyl)-1-oxopropan-2-yl]amino]methanesulfonic acid.
| Compound Name | [[(2S)-1-[(2R)-2-benzoyloxypropoxy]-3-(3,4-dihydroxyphenyl)-1-oxopropan-2-yl]amino]methanesulfonic acid |
|---|---|
| PubChem CID | 88941418 |
| Molecular Formula | C20H23NO9S |
| Molecular Weight | 453.47 g/mol |
| Exact Mass | 453.11 |
| IUPAC Name | [[(2S)-1-[(2R)-2-benzoyloxypropoxy]-3-(3,4-dihydroxyphenyl)-1-oxopropan-2-yl]amino]methanesulfonic acid |
| SMILES | C[C@H](COC(=O)[C@H](Cc1ccc(O)c(O)c1)NCS(=O)(=O)O)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C20H23NO9S/c1-13(30-19(24)15-5-3-2-4-6-15)11-29-20(25)16(21-12-31(26,27)28)9-14-7-8-17(22)18(23)10-14/h2-8,10,13,16,21-23H,9,11-12H2,1H3,(H,26,27,28)/t13-,16+/m1/s1 |
| InChIKey | NUCSIFCEUZJWCS-CJNGLKHVSA-N |
| XLogP | 1.23 |
| TPSA | 159.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.47 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|