C31H41ClN4O9 — CID 66935478
tert-butyl 4-[(1R)-1-[[(2R)-2-[(5-chloro-2-methoxyphenyl)methyl]-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]carbamoylamino]propyl]-2-nitrobenzoate (PubChem CID 66935478) has the molecular formula C31H41ClN4O9 and a molecular weight of 649.14 g/mol. Its IUPAC name is tert-butyl 4-[(1R)-1-[[(2R)-2-[(5-chloro-2-methoxyphenyl)methyl]-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]carbamoylamino]propyl]-2-nitrobenzoate.
| Compound Name | tert-butyl 4-[(1R)-1-[[(2R)-2-[(5-chloro-2-methoxyphenyl)methyl]-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]carbamoylamino]propyl]-2-nitrobenzoate |
|---|---|
| PubChem CID | 66935478 |
| Molecular Formula | C31H41ClN4O9 |
| Molecular Weight | 649.14 g/mol |
| Exact Mass | 648.26 |
| IUPAC Name | tert-butyl 4-[(1R)-1-[[(2R)-2-[(5-chloro-2-methoxyphenyl)methyl]-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]carbamoylamino]propyl]-2-nitrobenzoate |
| SMILES | CC[C@@H](NC(=O)NC(=O)[C@@H](CNC(=O)OC(C)(C)C)Cc1cc(Cl)ccc1OC)c1ccc(C(=O)OC(C)(C)C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C31H41ClN4O9/c1-9-23(18-10-12-22(24(16-18)36(41)42)27(38)44-30(2,3)4)34-28(39)35-26(37)20(17-33-29(40)45-31(5,6)7)14-19-15-21(32)11-13-25(19)43-8/h10-13,15-16,20,23H,9,14,17H2,1-8H3,(H,33,40)(H2,34,35,37,39)/t20-,23-/m1/s1 |
| InChIKey | CLKUYMASGGGRJP-NFBKMPQASA-N |
| XLogP | 5.87 |
| TPSA | 175.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.14 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|