C24H35NO8 — CID 66946343
(2S)-2-amino-3-[3,4-di(propanoyloxy)phenyl]-4-methyl-5-(3-methylpentanoyloxy)pentanoic acid (PubChem CID 66946343) has the molecular formula C24H35NO8 and a molecular weight of 465.54 g/mol. Its IUPAC name is (2S)-2-amino-3-[3,4-di(propanoyloxy)phenyl]-4-methyl-5-(3-methylpentanoyloxy)pentanoic acid.
| Compound Name | (2S)-2-amino-3-[3,4-di(propanoyloxy)phenyl]-4-methyl-5-(3-methylpentanoyloxy)pentanoic acid |
|---|---|
| PubChem CID | 66946343 |
| Molecular Formula | C24H35NO8 |
| Molecular Weight | 465.54 g/mol |
| Exact Mass | 465.24 |
| IUPAC Name | (2S)-2-amino-3-[3,4-di(propanoyloxy)phenyl]-4-methyl-5-(3-methylpentanoyloxy)pentanoic acid |
| SMILES | CCC(=O)Oc1ccc(C(C(C)COC(=O)CC(C)CC)[C@H](N)C(=O)O)cc1OC(=O)CC |
| InChI | InChI=1S/C24H35NO8/c1-6-14(4)11-21(28)31-13-15(5)22(23(25)24(29)30)16-9-10-17(32-19(26)7-2)18(12-16)33-20(27)8-3/h9-10,12,14-15,22-23H,6-8,11,13,25H2,1-5H3,(H,29,30)/t14?,15?,22?,23-/m0/s1 |
| InChIKey | GHQLYAUOZFFGDJ-UYDVTGPHSA-N |
| XLogP | 3.43 |
| TPSA | 142.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.54 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|