C14H14F3NO3 — CID 66962851
(3R,4S)-6-methoxy-2-methyl-4-(2,4,5-trifluorophenyl)-2,3,4,5-tetrahydropyridine-3-carboxylic acid (PubChem CID 66962851) has the molecular formula C14H14F3NO3 and a molecular weight of 301.26 g/mol. Its IUPAC name is (3R,4S)-6-methoxy-2-methyl-4-(2,4,5-trifluorophenyl)-2,3,4,5-tetrahydropyridine-3-carboxylic acid.
| Compound Name | (3R,4S)-6-methoxy-2-methyl-4-(2,4,5-trifluorophenyl)-2,3,4,5-tetrahydropyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 66962851 |
| Molecular Formula | C14H14F3NO3 |
| Molecular Weight | 301.26 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | (3R,4S)-6-methoxy-2-methyl-4-(2,4,5-trifluorophenyl)-2,3,4,5-tetrahydropyridine-3-carboxylic acid |
| SMILES | COC1=NC(C)[C@H](C(=O)O)[C@@H](c2cc(F)c(F)cc2F)C1 |
| InChI | InChI=1S/C14H14F3NO3/c1-6-13(14(19)20)8(4-12(18-6)21-2)7-3-10(16)11(17)5-9(7)15/h3,5-6,8,13H,4H2,1-2H3,(H,19,20)/t6?,8-,13+/m1/s1 |
| InChIKey | BPKBNDHPKPYHLP-XIYVFFDNSA-N |
| XLogP | 2.73 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.26 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|