C24H34F3N3O7 — CID 66963540
(2R)-2-[[(2S)-2-amino-2-[(2-methylpropan-2-yl)oxycarbonyl]-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]-3-(3,4,5-trifluorophenyl)propanoic acid (PubChem CID 66963540) has the molecular formula C24H34F3N3O7 and a molecular weight of 533.54 g/mol. Its IUPAC name is (2R)-2-[[(2S)-2-amino-2-[(2-methylpropan-2-yl)oxycarbonyl]-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]-3-(3,4,5-trifluorophenyl)propanoic acid.
| Compound Name | (2R)-2-[[(2S)-2-amino-2-[(2-methylpropan-2-yl)oxycarbonyl]-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]-3-(3,4,5-trifluorophenyl)propanoic acid |
|---|---|
| PubChem CID | 66963540 |
| Molecular Formula | C24H34F3N3O7 |
| Molecular Weight | 533.54 g/mol |
| Exact Mass | 533.23 |
| IUPAC Name | (2R)-2-[[(2S)-2-amino-2-[(2-methylpropan-2-yl)oxycarbonyl]-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]-3-(3,4,5-trifluorophenyl)propanoic acid |
| SMILES | CC(C)(C)OC(=O)NCCC[C@](N)(C(=O)N[C@H](Cc1cc(F)c(F)c(F)c1)C(=O)O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H34F3N3O7/c1-22(2,3)36-20(34)24(28,8-7-9-29-21(35)37-23(4,5)6)19(33)30-16(18(31)32)12-13-10-14(25)17(27)15(26)11-13/h10-11,16H,7-9,12,28H2,1-6H3,(H,29,35)(H,30,33)(H,31,32)/t16-,24+/m1/s1 |
| InChIKey | FICNCEGMGIEPGW-GYCJOSAFSA-N |
| XLogP | 2.56 |
| TPSA | 157.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.54 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|