C22H27N3O7 — CID 90916420
(2S)-2-[[(2R)-2,5-diamino-2-phenylmethoxycarbonylpentanoyl]amino]-3-(2,4-dihydroxyphenyl)propanoic acid (PubChem CID 90916420) has the molecular formula C22H27N3O7 and a molecular weight of 445.47 g/mol. Its IUPAC name is (2S)-2-[[(2R)-2,5-diamino-2-phenylmethoxycarbonylpentanoyl]amino]-3-(2,4-dihydroxyphenyl)propanoic acid.
| Compound Name | (2S)-2-[[(2R)-2,5-diamino-2-phenylmethoxycarbonylpentanoyl]amino]-3-(2,4-dihydroxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 90916420 |
| Molecular Formula | C22H27N3O7 |
| Molecular Weight | 445.47 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | (2S)-2-[[(2R)-2,5-diamino-2-phenylmethoxycarbonylpentanoyl]amino]-3-(2,4-dihydroxyphenyl)propanoic acid |
| SMILES | NCCC[C@@](N)(C(=O)N[C@@H](Cc1ccc(O)cc1O)C(=O)O)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C22H27N3O7/c23-10-4-9-22(24,21(31)32-13-14-5-2-1-3-6-14)20(30)25-17(19(28)29)11-15-7-8-16(26)12-18(15)27/h1-3,5-8,12,17,26-27H,4,9-11,13,23-24H2,(H,25,30)(H,28,29)/t17-,22+/m0/s1 |
| InChIKey | FDKNVXAYHRWVQS-HTAPYJJXSA-N |
| XLogP | 0.39 |
| TPSA | 185.20 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.47 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|