C22H25F2N3 — CID 66964749
5-(2,4-difluorophenyl)-2-methyl-8-(4-methylpiperazin-1-yl)-1,3-dihydro-2-benzazepine (PubChem CID 66964749) has the molecular formula C22H25F2N3 and a molecular weight of 369.46 g/mol. Its IUPAC name is 5-(2,4-difluorophenyl)-2-methyl-8-(4-methylpiperazin-1-yl)-1,3-dihydro-2-benzazepine.
| Compound Name | 5-(2,4-difluorophenyl)-2-methyl-8-(4-methylpiperazin-1-yl)-1,3-dihydro-2-benzazepine |
|---|---|
| PubChem CID | 66964749 |
| Molecular Formula | C22H25F2N3 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.20 |
| IUPAC Name | 5-(2,4-difluorophenyl)-2-methyl-8-(4-methylpiperazin-1-yl)-1,3-dihydro-2-benzazepine |
| SMILES | CN1CCN(c2ccc3c(c2)CN(C)CC=C3c2ccc(F)cc2F)CC1 |
| InChI | InChI=1S/C22H25F2N3/c1-25-9-11-27(12-10-25)18-4-6-19-16(13-18)15-26(2)8-7-20(19)21-5-3-17(23)14-22(21)24/h3-7,13-14H,8-12,15H2,1-2H3 |
| InChIKey | SFZDSTFFEIULAH-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|