About ethyl (2-hydroxyphenyl) (2-nitrophenyl) phosphate
ethyl (2-hydroxyphenyl) (2-nitrophenyl) phosphate (PubChem CID 66973952) has the molecular formula C14H14NO7P
and a molecular weight of 339.24 g/mol. Its IUPAC name is ethyl (2-hydroxyphenyl) (2-nitrophenyl) phosphate.
Molecular Properties
| Compound Name | ethyl (2-hydroxyphenyl) (2-nitrophenyl) phosphate |
| PubChem CID | 66973952 |
| Molecular Formula | C14H14NO7P |
| Molecular Weight | 339.24 g/mol |
| Exact Mass | 339.05 |
| IUPAC Name | ethyl (2-hydroxyphenyl) (2-nitrophenyl) phosphate |
| SMILES | CCOP(=O)(Oc1ccccc1O)Oc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H14NO7P/c1-2-20-23(19,22-14-10-6-4-8-12(14)16)21-13-9-5-3-7-11(13)15(17)18/h3-10,16H,2H2,1H3 |
| InChIKey | UEQVVOMFILZHBB-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 108.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.24 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze ethyl (2-hydroxyphenyl) (2-nitrophenyl) phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (2-hydroxyphenyl) (2-nitrophenyl) phosphate?
The IUPAC name of ethyl (2-hydroxyphenyl) (2-nitrophenyl) phosphate (CID 66973952) is ethyl (2-hydroxyphenyl) (2-nitrophenyl) phosphate.
What is the SMILES notation for ethyl (2-hydroxyphenyl) (2-nitrophenyl) phosphate?
The canonical SMILES for ethyl (2-hydroxyphenyl) (2-nitrophenyl) phosphate is CCOP(=O)(Oc1ccccc1O)Oc1ccccc1[N+](=O)[O-].
What is the InChIKey of ethyl (2-hydroxyphenyl) (2-nitrophenyl) phosphate?
The InChIKey is UEQVVOMFILZHBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14NO7P/c1-2-20-23(19,22-14-10-6-4-8-12(14)16)21-13-9-5-3-7-11(13)15(17)18/h3-10,16H,2H2,1H3.
What are the key properties of ethyl (2-hydroxyphenyl) (2-nitrophenyl) phosphate?
ethyl (2-hydroxyphenyl) (2-nitrophenyl) phosphate has a molecular weight of 339.24 g/mol, XLogP of 3.90, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (2-hydroxyphenyl) (2-nitrophenyl) phosphate is sourced from PubChem (CID 66973952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).