C21H31F2N3O — CID 66997444
(2S)-N-[(3aR,4S,6aS)-2-[2-(difluoromethyl)phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-4-methyl-2-(methylamino)pentanamide (PubChem CID 66997444) has the molecular formula C21H31F2N3O and a molecular weight of 379.50 g/mol. Its IUPAC name is (2S)-N-[(3aR,4S,6aS)-2-[2-(difluoromethyl)phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-4-methyl-2-(methylamino)pentanamide.
| Compound Name | (2S)-N-[(3aR,4S,6aS)-2-[2-(difluoromethyl)phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-4-methyl-2-(methylamino)pentanamide |
|---|---|
| PubChem CID | 66997444 |
| Molecular Formula | C21H31F2N3O |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.24 |
| IUPAC Name | (2S)-N-[(3aR,4S,6aS)-2-[2-(difluoromethyl)phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-4-methyl-2-(methylamino)pentanamide |
| SMILES | CN[C@@H](CC(C)C)C(=O)N[C@H]1CC[C@@H]2CN(c3ccccc3C(F)F)C[C@@H]21 |
| InChI | InChI=1S/C21H31F2N3O/c1-13(2)10-18(24-3)21(27)25-17-9-8-14-11-26(12-16(14)17)19-7-5-4-6-15(19)20(22)23/h4-7,13-14,16-18,20,24H,8-12H2,1-3H3,(H,25,27)/t14-,16+,17+,18+/m1/s1 |
| InChIKey | DDJSOESVQZSANR-UBDQQSCGSA-N |
| XLogP | 3.59 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |