C25H24FN3O2 — CID 66998227
6-[(E)-3-(dimethylamino)-2-methylprop-2-enoyl]-3-(4-fluorophenyl)-1,9-dimethylpyrido[2,3-b]indol-2-one (PubChem CID 66998227) has the molecular formula C25H24FN3O2 and a molecular weight of 417.48 g/mol. Its IUPAC name is 6-[(E)-3-(dimethylamino)-2-methylprop-2-enoyl]-3-(4-fluorophenyl)-1,9-dimethylpyrido[2,3-b]indol-2-one.
| Compound Name | 6-[(E)-3-(dimethylamino)-2-methylprop-2-enoyl]-3-(4-fluorophenyl)-1,9-dimethylpyrido[2,3-b]indol-2-one |
|---|---|
| PubChem CID | 66998227 |
| Molecular Formula | C25H24FN3O2 |
| Molecular Weight | 417.48 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | 6-[(E)-3-(dimethylamino)-2-methylprop-2-enoyl]-3-(4-fluorophenyl)-1,9-dimethylpyrido[2,3-b]indol-2-one |
| SMILES | C/C(=C\N(C)C)C(=O)c1ccc2c(c1)c1cc(-c3ccc(F)cc3)c(=O)n(C)c1n2C |
| InChI | InChI=1S/C25H24FN3O2/c1-15(14-27(2)3)23(30)17-8-11-22-20(12-17)21-13-19(16-6-9-18(26)10-7-16)25(31)29(5)24(21)28(22)4/h6-14H,1-5H3/b15-14+ |
| InChIKey | ALMAVKYOXSLPJL-CCEZHUSRSA-N |
| XLogP | 4.48 |
| TPSA | 47.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.48 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|