About 1,9-dimethyl-2-oxo-3-phenylpyrido[2,3-b]indole-6-carboxylic acid
1,9-dimethyl-2-oxo-3-phenylpyrido[2,3-b]indole-6-carboxylic acid (PubChem CID 68695734) has the molecular formula C20H16N2O3
and a molecular weight of 332.36 g/mol. Its IUPAC name is 1,9-dimethyl-2-oxo-3-phenylpyrido[2,3-b]indole-6-carboxylic acid.
Molecular Properties
| Compound Name | 1,9-dimethyl-2-oxo-3-phenylpyrido[2,3-b]indole-6-carboxylic acid |
| PubChem CID | 68695734 |
| Molecular Formula | C20H16N2O3 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | 1,9-dimethyl-2-oxo-3-phenylpyrido[2,3-b]indole-6-carboxylic acid |
| SMILES | Cn1c(=O)c(-c2ccccc2)cc2c3cc(C(=O)O)ccc3n(C)c21 |
| InChI | InChI=1S/C20H16N2O3/c1-21-17-9-8-13(20(24)25)10-15(17)16-11-14(12-6-4-3-5-7-12)19(23)22(2)18(16)21/h3-11H,1-2H3,(H,24,25) |
| InChIKey | SEEJKEISPOSPDD-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 64.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,9-dimethyl-2-oxo-3-phenylpyrido[2,3-b]indole-6-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,9-dimethyl-2-oxo-3-phenylpyrido[2,3-b]indole-6-carboxylic acid?
The IUPAC name of 1,9-dimethyl-2-oxo-3-phenylpyrido[2,3-b]indole-6-carboxylic acid (CID 68695734) is 1,9-dimethyl-2-oxo-3-phenylpyrido[2,3-b]indole-6-carboxylic acid.
What is the SMILES notation for 1,9-dimethyl-2-oxo-3-phenylpyrido[2,3-b]indole-6-carboxylic acid?
The canonical SMILES for 1,9-dimethyl-2-oxo-3-phenylpyrido[2,3-b]indole-6-carboxylic acid is Cn1c(=O)c(-c2ccccc2)cc2c3cc(C(=O)O)ccc3n(C)c21.
What is the InChIKey of 1,9-dimethyl-2-oxo-3-phenylpyrido[2,3-b]indole-6-carboxylic acid?
The InChIKey is SEEJKEISPOSPDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16N2O3/c1-21-17-9-8-13(20(24)25)10-15(17)16-11-14(12-6-4-3-5-7-12)19(23)22(2)18(16)21/h3-11H,1-2H3,(H,24,25).
What are the key properties of 1,9-dimethyl-2-oxo-3-phenylpyrido[2,3-b]indole-6-carboxylic acid?
1,9-dimethyl-2-oxo-3-phenylpyrido[2,3-b]indole-6-carboxylic acid has a molecular weight of 332.36 g/mol, XLogP of 3.40, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,9-dimethyl-2-oxo-3-phenylpyrido[2,3-b]indole-6-carboxylic acid is sourced from PubChem (CID 68695734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).