C18H25ClN8 — CID 67002017
8-[(2-amino-3-chlorophenyl)methyl]-2-N-(2-aminopropyl)-9-propan-2-ylpurine-2,6-diamine (PubChem CID 67002017) has the molecular formula C18H25ClN8 and a molecular weight of 388.91 g/mol. Its IUPAC name is 8-[(2-amino-3-chlorophenyl)methyl]-2-N-(2-aminopropyl)-9-propan-2-ylpurine-2,6-diamine.
| Compound Name | 8-[(2-amino-3-chlorophenyl)methyl]-2-N-(2-aminopropyl)-9-propan-2-ylpurine-2,6-diamine |
|---|---|
| PubChem CID | 67002017 |
| Molecular Formula | C18H25ClN8 |
| Molecular Weight | 388.91 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | 8-[(2-amino-3-chlorophenyl)methyl]-2-N-(2-aminopropyl)-9-propan-2-ylpurine-2,6-diamine |
| SMILES | CC(N)CNc1nc(N)c2nc(Cc3cccc(Cl)c3N)n(C(C)C)c2n1 |
| InChI | InChI=1S/C18H25ClN8/c1-9(2)27-13(7-11-5-4-6-12(19)14(11)21)24-15-16(22)25-18(26-17(15)27)23-8-10(3)20/h4-6,9-10H,7-8,20-21H2,1-3H3,(H3,22,23,25,26) |
| InChIKey | FUJBRMUSQPOQAS-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 133.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.91 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|