C22H28N10 — CID 67002796
2-N-(2-aminopropyl)-9-benzyl-8-N-[(2,3-diaminophenyl)methyl]purine-2,6,8-triamine (PubChem CID 67002796) has the molecular formula C22H28N10 and a molecular weight of 432.54 g/mol. Its IUPAC name is 2-N-(2-aminopropyl)-9-benzyl-8-N-[(2,3-diaminophenyl)methyl]purine-2,6,8-triamine.
| Compound Name | 2-N-(2-aminopropyl)-9-benzyl-8-N-[(2,3-diaminophenyl)methyl]purine-2,6,8-triamine |
|---|---|
| PubChem CID | 67002796 |
| Molecular Formula | C22H28N10 |
| Molecular Weight | 432.54 g/mol |
| Exact Mass | 432.25 |
| IUPAC Name | 2-N-(2-aminopropyl)-9-benzyl-8-N-[(2,3-diaminophenyl)methyl]purine-2,6,8-triamine |
| SMILES | CC(N)CNc1nc(N)c2nc(NCc3cccc(N)c3N)n(Cc3ccccc3)c2n1 |
| InChI | InChI=1S/C22H28N10/c1-13(23)10-27-21-30-19(26)18-20(31-21)32(12-14-6-3-2-4-7-14)22(29-18)28-11-15-8-5-9-16(24)17(15)25/h2-9,13H,10-12,23-25H2,1H3,(H,28,29)(H3,26,27,30,31) |
| InChIKey | HBODIWPKVBULEW-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 171.74 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.54 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|