C11H13NO5 — CID 67004415
(2R,3S)-5-(3-aminophenoxy)-2-(hydroxymethyl)-2,3-dihydrofuran-3,4-diol (PubChem CID 67004415) has the molecular formula C11H13NO5 and a molecular weight of 239.23 g/mol. Its IUPAC name is (2R,3S)-5-(3-aminophenoxy)-2-(hydroxymethyl)-2,3-dihydrofuran-3,4-diol.
| Compound Name | (2R,3S)-5-(3-aminophenoxy)-2-(hydroxymethyl)-2,3-dihydrofuran-3,4-diol |
|---|---|
| PubChem CID | 67004415 |
| Molecular Formula | C11H13NO5 |
| Molecular Weight | 239.23 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | (2R,3S)-5-(3-aminophenoxy)-2-(hydroxymethyl)-2,3-dihydrofuran-3,4-diol |
| SMILES | Nc1cccc(OC2=C(O)[C@@H](O)[C@@H](CO)O2)c1 |
| InChI | InChI=1S/C11H13NO5/c12-6-2-1-3-7(4-6)16-11-10(15)9(14)8(5-13)17-11/h1-4,8-9,13-15H,5,12H2/t8-,9+/m1/s1 |
| InChIKey | HFFDIPDTLPNISC-BDAKNGLRSA-N |
| XLogP | 0.13 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.23 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|