C24H26ClN5OS — CID 67014862
1-[(4-aminoquinazolin-7-yl)methyl]-4-[3-(5-chlorothiophen-2-yl)prop-2-enyl]-4a,5,6,7,8,8a-hexahydro-3H-quinoxalin-2-one (PubChem CID 67014862) has the molecular formula C24H26ClN5OS and a molecular weight of 468.03 g/mol. Its IUPAC name is 1-[(4-aminoquinazolin-7-yl)methyl]-4-[3-(5-chlorothiophen-2-yl)prop-2-enyl]-4a,5,6,7,8,8a-hexahydro-3H-quinoxalin-2-one.
| Compound Name | 1-[(4-aminoquinazolin-7-yl)methyl]-4-[3-(5-chlorothiophen-2-yl)prop-2-enyl]-4a,5,6,7,8,8a-hexahydro-3H-quinoxalin-2-one |
|---|---|
| PubChem CID | 67014862 |
| Molecular Formula | C24H26ClN5OS |
| Molecular Weight | 468.03 g/mol |
| Exact Mass | 467.15 |
| IUPAC Name | 1-[(4-aminoquinazolin-7-yl)methyl]-4-[3-(5-chlorothiophen-2-yl)prop-2-enyl]-4a,5,6,7,8,8a-hexahydro-3H-quinoxalin-2-one |
| SMILES | Nc1ncnc2cc(CN3C(=O)CN(CC=Cc4ccc(Cl)s4)C4CCCCC43)ccc12 |
| InChI | InChI=1S/C24H26ClN5OS/c25-22-10-8-17(32-22)4-3-11-29-14-23(31)30(21-6-2-1-5-20(21)29)13-16-7-9-18-19(12-16)27-15-28-24(18)26/h3-4,7-10,12,15,20-21H,1-2,5-6,11,13-14H2,(H2,26,27,28) |
| InChIKey | IAAABRKLIYEYTR-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.03 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |