C24H26ClN5O2S — CID 69026379
1-[(4-aminoquinazolin-7-yl)methyl]-5-butyl-4-[(E)-3-(5-chlorothiophen-2-yl)prop-2-enyl]piperazine-2,3-dione (PubChem CID 69026379) has the molecular formula C24H26ClN5O2S and a molecular weight of 484.03 g/mol. Its IUPAC name is 1-[(4-aminoquinazolin-7-yl)methyl]-5-butyl-4-[(E)-3-(5-chlorothiophen-2-yl)prop-2-enyl]piperazine-2,3-dione.
| Compound Name | 1-[(4-aminoquinazolin-7-yl)methyl]-5-butyl-4-[(E)-3-(5-chlorothiophen-2-yl)prop-2-enyl]piperazine-2,3-dione |
|---|---|
| PubChem CID | 69026379 |
| Molecular Formula | C24H26ClN5O2S |
| Molecular Weight | 484.03 g/mol |
| Exact Mass | 483.15 |
| IUPAC Name | 1-[(4-aminoquinazolin-7-yl)methyl]-5-butyl-4-[(E)-3-(5-chlorothiophen-2-yl)prop-2-enyl]piperazine-2,3-dione |
| SMILES | CCCCC1CN(Cc2ccc3c(N)ncnc3c2)C(=O)C(=O)N1C/C=C/c1ccc(Cl)s1 |
| InChI | InChI=1S/C24H26ClN5O2S/c1-2-3-5-17-14-29(13-16-7-9-19-20(12-16)27-15-28-22(19)26)23(31)24(32)30(17)11-4-6-18-8-10-21(25)33-18/h4,6-10,12,15,17H,2-3,5,11,13-14H2,1H3,(H2,26,27,28)/b6-4+ |
| InChIKey | QBWGNJQJSYCUHW-GQCTYLIASA-N |
| XLogP | 4.37 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.03 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|