C9H14N4O2 — CID 67025774
tert-butyl 1-carbamimidoylpyrazole-3-carboxylate (PubChem CID 67025774) has the molecular formula C9H14N4O2 and a molecular weight of 210.24 g/mol. Its IUPAC name is tert-butyl 1-carbamimidoylpyrazole-3-carboxylate.
| Compound Name | tert-butyl 1-carbamimidoylpyrazole-3-carboxylate |
|---|---|
| PubChem CID | 67025774 |
| Molecular Formula | C9H14N4O2 |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | tert-butyl 1-carbamimidoylpyrazole-3-carboxylate |
| SMILES | [H]/N=C(\N)n1ccc(C(=O)OC(C)(C)C)n1 |
| InChI | InChI=1S/C9H14N4O2/c1-9(2,3)15-7(14)6-4-5-13(12-6)8(10)11/h4-5H,1-3H3,(H3,10,11) |
| InChIKey | GDKYNMQBGVLYPS-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 93.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|